C26H31F3N4O2 — CID 162575800
[8-(3,6-dihydro-2H-pyran-4-yl)-8-methyl-7,11-dihydro-5H-pyrido[3,2-c][1,5]benzodiazepin-6-yl]-[1-(2,2,2-trifluoroethyl)piperidin-4-yl]methanone (PubChem CID 162575800) has the molecular formula C26H31F3N4O2 and a molecular weight of 488.55 g/mol. Its IUPAC name is [8-(3,6-dihydro-2H-pyran-4-yl)-8-methyl-7,11-dihydro-5H-pyrido[3,2-c][1,5]benzodiazepin-6-yl]-[1-(2,2,2-trifluoroethyl)piperidin-4-yl]methanone.
| Compound Name | [8-(3,6-dihydro-2H-pyran-4-yl)-8-methyl-7,11-dihydro-5H-pyrido[3,2-c][1,5]benzodiazepin-6-yl]-[1-(2,2,2-trifluoroethyl)piperidin-4-yl]methanone |
|---|---|
| PubChem CID | 162575800 |
| Molecular Formula | C26H31F3N4O2 |
| Molecular Weight | 488.55 g/mol |
| Exact Mass | 488.24 |
| IUPAC Name | [8-(3,6-dihydro-2H-pyran-4-yl)-8-methyl-7,11-dihydro-5H-pyrido[3,2-c][1,5]benzodiazepin-6-yl]-[1-(2,2,2-trifluoroethyl)piperidin-4-yl]methanone |
| SMILES | CC1(C2=CCOCC2)C=CC2=C(C1)N(C(=O)C1CCN(CC(F)(F)F)CC1)Cc1cccnc1N2 |
| InChI | InChI=1S/C26H31F3N4O2/c1-25(20-7-13-35-14-8-20)9-4-21-22(15-25)33(16-19-3-2-10-30-23(19)31-21)24(34)18-5-11-32(12-6-18)17-26(27,28)29/h2-4,7,9-10,18H,5-6,8,11-17H2,1H3,(H,30,31) |
| InChIKey | LBZQQOSAWSFJFH-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 57.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.55 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|