C27H30F5N5O2 — CID 129080727
[3,9-difluoro-8-(6-oxa-2-azaspiro[3.5]nonan-2-yl)-5,11-dihydropyrido[3,2-c][1,5]benzodiazepin-6-yl]-[1-(2,2,2-trifluoroethyl)piperidin-4-yl]methanone (PubChem CID 129080727) has the molecular formula C27H30F5N5O2 and a molecular weight of 551.56 g/mol. Its IUPAC name is [3,9-difluoro-8-(6-oxa-2-azaspiro[3.5]nonan-2-yl)-5,11-dihydropyrido[3,2-c][1,5]benzodiazepin-6-yl]-[1-(2,2,2-trifluoroethyl)piperidin-4-yl]methanone.
| Compound Name | [3,9-difluoro-8-(6-oxa-2-azaspiro[3.5]nonan-2-yl)-5,11-dihydropyrido[3,2-c][1,5]benzodiazepin-6-yl]-[1-(2,2,2-trifluoroethyl)piperidin-4-yl]methanone |
|---|---|
| PubChem CID | 129080727 |
| Molecular Formula | C27H30F5N5O2 |
| Molecular Weight | 551.56 g/mol |
| Exact Mass | 551.23 |
| IUPAC Name | [3,9-difluoro-8-(6-oxa-2-azaspiro[3.5]nonan-2-yl)-5,11-dihydropyrido[3,2-c][1,5]benzodiazepin-6-yl]-[1-(2,2,2-trifluoroethyl)piperidin-4-yl]methanone |
| SMILES | O=C(C1CCN(CC(F)(F)F)CC1)N1Cc2cc(F)cnc2Nc2cc(F)c(N3CC4(CCCOC4)C3)cc21 |
| InChI | InChI=1S/C27H30F5N5O2/c28-19-8-18-12-37(25(38)17-2-5-35(6-3-17)15-27(30,31)32)23-10-22(20(29)9-21(23)34-24(18)33-11-19)36-13-26(14-36)4-1-7-39-16-26/h8-11,17H,1-7,12-16H2,(H,33,34) |
| InChIKey | SPYRIRSSUCUKAW-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 60.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.56 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |