C20H30N4 — CID 139456203
7-[(1-methylazetidin-3-yl)amino]-5-[(2-phenylcyclopropyl)amino]heptanenitrile (PubChem CID 139456203) has the molecular formula C20H30N4 and a molecular weight of 326.49 g/mol. Its IUPAC name is 7-[(1-methylazetidin-3-yl)amino]-5-[(2-phenylcyclopropyl)amino]heptanenitrile.
| Compound Name | 7-[(1-methylazetidin-3-yl)amino]-5-[(2-phenylcyclopropyl)amino]heptanenitrile |
|---|---|
| PubChem CID | 139456203 |
| Molecular Formula | C20H30N4 |
| Molecular Weight | 326.49 g/mol |
| Exact Mass | 326.25 |
| IUPAC Name | 7-[(1-methylazetidin-3-yl)amino]-5-[(2-phenylcyclopropyl)amino]heptanenitrile |
| SMILES | CN1CC(NCCC(CCCC#N)NC2CC2c2ccccc2)C1 |
| InChI | InChI=1S/C20H30N4/c1-24-14-18(15-24)22-12-10-17(9-5-6-11-21)23-20-13-19(20)16-7-3-2-4-8-16/h2-4,7-8,17-20,22-23H,5-6,9-10,12-15H2,1H3 |
| InChIKey | PNSQRXCKASUCOA-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 51.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.49 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|