C24H44N4O2 — CID 139456564
N'-[[3-[4,4-bis(ethoxymethyl)cyclohexyl]-4,5,6,7-tetrahydropyrazolo[1,5-a]pyridin-2-yl]methyl]-N,N'-dimethylethane-1,2-diamine (PubChem CID 139456564) has the molecular formula C24H44N4O2 and a molecular weight of 420.64 g/mol. Its IUPAC name is N'-[[3-[4,4-bis(ethoxymethyl)cyclohexyl]-4,5,6,7-tetrahydropyrazolo[1,5-a]pyridin-2-yl]methyl]-N,N'-dimethylethane-1,2-diamine.
| Compound Name | N'-[[3-[4,4-bis(ethoxymethyl)cyclohexyl]-4,5,6,7-tetrahydropyrazolo[1,5-a]pyridin-2-yl]methyl]-N,N'-dimethylethane-1,2-diamine |
|---|---|
| PubChem CID | 139456564 |
| Molecular Formula | C24H44N4O2 |
| Molecular Weight | 420.64 g/mol |
| Exact Mass | 420.35 |
| IUPAC Name | N'-[[3-[4,4-bis(ethoxymethyl)cyclohexyl]-4,5,6,7-tetrahydropyrazolo[1,5-a]pyridin-2-yl]methyl]-N,N'-dimethylethane-1,2-diamine |
| SMILES | CCOCC1(COCC)CCC(c2c(CN(C)CCNC)nn3c2CCCC3)CC1 |
| InChI | InChI=1S/C24H44N4O2/c1-5-29-18-24(19-30-6-2)12-10-20(11-13-24)23-21(17-27(4)16-14-25-3)26-28-15-8-7-9-22(23)28/h20,25H,5-19H2,1-4H3 |
| InChIKey | KFJMEMCDJBWBTD-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 51.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.64 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |