C25H33ClN2O5S — CID 139458179
(3E,5E,8R)-21-chloro-8-hydroxy-22-methoxy-3,16,19-trimethyl-11-oxa-14-thia-9,19-diazatricyclo[18.3.1.18,12]pentacosa-1(24),3,5,20,22-pentaene-10,18-dione (PubChem CID 139458179) has the molecular formula C25H33ClN2O5S and a molecular weight of 509.07 g/mol. Its IUPAC name is (3E,5E,8R)-21-chloro-8-hydroxy-22-methoxy-3,16,19-trimethyl-11-oxa-14-thia-9,19-diazatricyclo[18.3.1.18,12]pentacosa-1(24),3,5,20,22-pentaene-10,18-dione.
| Compound Name | (3E,5E,8R)-21-chloro-8-hydroxy-22-methoxy-3,16,19-trimethyl-11-oxa-14-thia-9,19-diazatricyclo[18.3.1.18,12]pentacosa-1(24),3,5,20,22-pentaene-10,18-dione |
|---|---|
| PubChem CID | 139458179 |
| Molecular Formula | C25H33ClN2O5S |
| Molecular Weight | 509.07 g/mol |
| Exact Mass | 508.18 |
| IUPAC Name | (3E,5E,8R)-21-chloro-8-hydroxy-22-methoxy-3,16,19-trimethyl-11-oxa-14-thia-9,19-diazatricyclo[18.3.1.18,12]pentacosa-1(24),3,5,20,22-pentaene-10,18-dione |
| SMILES | COc1cc2cc(c1Cl)N(C)C(=O)CC(C)CSCC1C[C@](O)(C/C=C/C=C(\C)C2)NC(=O)O1 |
| InChI | InChI=1S/C25H33ClN2O5S/c1-16-7-5-6-8-25(31)13-19(33-24(30)27-25)15-34-14-17(2)10-22(29)28(3)20-11-18(9-16)12-21(32-4)23(20)26/h5-7,11-12,17,19,31H,8-10,13-15H2,1-4H3,(H,27,30)/b6-5+,16-7+/t17?,19?,25-/m1/s1 |
| InChIKey | QLNWJOJYOFBHMR-PVMSDOCUSA-N |
| XLogP | 4.71 |
| TPSA | 88.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.07 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |