C29H39ClN2O7 — CID 24883885
(3E,5E,14E)-21-chloro-16-hydroxy-7,8,22-trimethoxy-3,13,15,19-tetramethyl-11-oxa-9,19-diazatricyclo[18.3.1.18,12]pentacosa-1(24),3,5,14,20,22-hexaene-10,18-dione (PubChem CID 24883885) has the molecular formula C29H39ClN2O7 and a molecular weight of 563.09 g/mol. Its IUPAC name is (3E,5E,14E)-21-chloro-16-hydroxy-7,8,22-trimethoxy-3,13,15,19-tetramethyl-11-oxa-9,19-diazatricyclo[18.3.1.18,12]pentacosa-1(24),3,5,14,20,22-hexaene-10,18-dione.
| Compound Name | (3E,5E,14E)-21-chloro-16-hydroxy-7,8,22-trimethoxy-3,13,15,19-tetramethyl-11-oxa-9,19-diazatricyclo[18.3.1.18,12]pentacosa-1(24),3,5,14,20,22-hexaene-10,18-dione |
|---|---|
| PubChem CID | 24883885 |
| Molecular Formula | C29H39ClN2O7 |
| Molecular Weight | 563.09 g/mol |
| Exact Mass | 562.24 |
| IUPAC Name | (3E,5E,14E)-21-chloro-16-hydroxy-7,8,22-trimethoxy-3,13,15,19-tetramethyl-11-oxa-9,19-diazatricyclo[18.3.1.18,12]pentacosa-1(24),3,5,14,20,22-hexaene-10,18-dione |
| SMILES | COc1cc2cc(c1Cl)N(C)C(=O)CC(O)/C(C)=C/C(C)C1CC(OC)(NC(=O)O1)C(OC)/C=C/C=C(\C)C2 |
| InChI | InChI=1S/C29H39ClN2O7/c1-17-9-8-10-25(37-6)29(38-7)16-24(39-28(35)31-29)19(3)12-18(2)22(33)15-26(34)32(4)21-13-20(11-17)14-23(36-5)27(21)30/h8-10,12-14,19,22,24-25,33H,11,15-16H2,1-7H3,(H,31,35)/b10-8+,17-9+,18-12+ |
| InChIKey | YXFUMAMSKPPTCV-MGQIMKPRSA-N |
| XLogP | 4.56 |
| TPSA | 106.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.09 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|