C28H37ClN2O7 — CID 5373233
(3E,5E,14E)-21-chloro-8,16-dihydroxy-7,22-dimethoxy-3,13,15,19-tetramethyl-11-oxa-9,19-diazatricyclo[18.3.1.18,12]pentacosa-1(24),3,5,14,20,22-hexaene-10,18-dione (PubChem CID 5373233) has the molecular formula C28H37ClN2O7 and a molecular weight of 549.06 g/mol. Its IUPAC name is (3E,5E,14E)-21-chloro-8,16-dihydroxy-7,22-dimethoxy-3,13,15,19-tetramethyl-11-oxa-9,19-diazatricyclo[18.3.1.18,12]pentacosa-1(24),3,5,14,20,22-hexaene-10,18-dione.
| Compound Name | (3E,5E,14E)-21-chloro-8,16-dihydroxy-7,22-dimethoxy-3,13,15,19-tetramethyl-11-oxa-9,19-diazatricyclo[18.3.1.18,12]pentacosa-1(24),3,5,14,20,22-hexaene-10,18-dione |
|---|---|
| PubChem CID | 5373233 |
| Molecular Formula | C28H37ClN2O7 |
| Molecular Weight | 549.06 g/mol |
| Exact Mass | 548.23 |
| IUPAC Name | (3E,5E,14E)-21-chloro-8,16-dihydroxy-7,22-dimethoxy-3,13,15,19-tetramethyl-11-oxa-9,19-diazatricyclo[18.3.1.18,12]pentacosa-1(24),3,5,14,20,22-hexaene-10,18-dione |
| SMILES | COc1cc2cc(c1Cl)N(C)C(=O)CC(O)/C(C)=C/C(C)C1CC(O)(NC(=O)O1)C(OC)/C=C/C=C(\C)C2 |
| InChI | InChI=1S/C28H37ClN2O7/c1-16-8-7-9-24(37-6)28(35)15-23(38-27(34)30-28)18(3)11-17(2)21(32)14-25(33)31(4)20-12-19(10-16)13-22(36-5)26(20)29/h7-9,11-13,18,21,23-24,32,35H,10,14-15H2,1-6H3,(H,30,34)/b9-7+,16-8+,17-11+ |
| InChIKey | VOMDBFPWVHDWOX-XRBZWANYSA-N |
| XLogP | 3.91 |
| TPSA | 117.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.06 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|