C28H38N2O7 — CID 162908060
8,16-dihydroxy-7,22-dimethoxy-3,13,15,19-tetramethyl-11-oxa-9,19-diazatricyclo[18.3.1.18,12]pentacosa-1(24),3,5,14,20,22-hexaene-10,18-dione (PubChem CID 162908060) has the molecular formula C28H38N2O7 and a molecular weight of 514.62 g/mol. Its IUPAC name is 8,16-dihydroxy-7,22-dimethoxy-3,13,15,19-tetramethyl-11-oxa-9,19-diazatricyclo[18.3.1.18,12]pentacosa-1(24),3,5,14,20,22-hexaene-10,18-dione.
| Compound Name | 8,16-dihydroxy-7,22-dimethoxy-3,13,15,19-tetramethyl-11-oxa-9,19-diazatricyclo[18.3.1.18,12]pentacosa-1(24),3,5,14,20,22-hexaene-10,18-dione |
|---|---|
| PubChem CID | 162908060 |
| Molecular Formula | C28H38N2O7 |
| Molecular Weight | 514.62 g/mol |
| Exact Mass | 514.27 |
| IUPAC Name | 8,16-dihydroxy-7,22-dimethoxy-3,13,15,19-tetramethyl-11-oxa-9,19-diazatricyclo[18.3.1.18,12]pentacosa-1(24),3,5,14,20,22-hexaene-10,18-dione |
| SMILES | COc1cc2cc(c1)N(C)C(=O)CC(O)C(C)=CC(C)C1CC(O)(NC(=O)O1)C(OC)C=CC=C(C)C2 |
| InChI | InChI=1S/C28H38N2O7/c1-17-8-7-9-25(36-6)28(34)16-24(37-27(33)29-28)19(3)11-18(2)23(31)15-26(32)30(4)21-12-20(10-17)13-22(14-21)35-5/h7-9,11-14,19,23-25,31,34H,10,15-16H2,1-6H3,(H,29,33) |
| InChIKey | QMNKTIXVKLDROC-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 117.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.62 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|