C27H33ClN2O6 — CID 3627091
21-chloro-8-hydroxy-7,22-dimethoxy-3,13,15-trimethyl-11-oxa-9,19-diazatricyclo[18.3.1.18,12]pentacosa-1(24),3,5,14,16,20,22-heptaene-10,18-dione (PubChem CID 3627091) has the molecular formula C27H33ClN2O6 and a molecular weight of 517.02 g/mol. Its IUPAC name is 21-chloro-8-hydroxy-7,22-dimethoxy-3,13,15-trimethyl-11-oxa-9,19-diazatricyclo[18.3.1.18,12]pentacosa-1(24),3,5,14,16,20,22-heptaene-10,18-dione.
| Compound Name | 21-chloro-8-hydroxy-7,22-dimethoxy-3,13,15-trimethyl-11-oxa-9,19-diazatricyclo[18.3.1.18,12]pentacosa-1(24),3,5,14,16,20,22-heptaene-10,18-dione |
|---|---|
| PubChem CID | 3627091 |
| Molecular Formula | C27H33ClN2O6 |
| Molecular Weight | 517.02 g/mol |
| Exact Mass | 516.20 |
| IUPAC Name | 21-chloro-8-hydroxy-7,22-dimethoxy-3,13,15-trimethyl-11-oxa-9,19-diazatricyclo[18.3.1.18,12]pentacosa-1(24),3,5,14,16,20,22-heptaene-10,18-dione |
| SMILES | COc1cc2cc(c1Cl)NC(=O)C=CC(C)=CC(C)C1CC(O)(NC(=O)O1)C(OC)C=CC=C(C)C2 |
| InChI | InChI=1S/C27H33ClN2O6/c1-16-7-6-8-23(35-5)27(33)15-22(36-26(32)30-27)18(3)11-17(2)9-10-24(31)29-20-13-19(12-16)14-21(34-4)25(20)28/h6-11,13-14,18,22-23,33H,12,15H2,1-5H3,(H,29,31)(H,30,32) |
| InChIKey | PWFGDMBLNXAYAR-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 106.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.02 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |