C22H48N6O — CID 139459336
1-[4-[1-[[amino-(propan-2-ylamino)methylidene]amino]ethyl]-7-(tert-butylamino)-6-methylheptan-2-yl]-3-propan-2-ylurea (PubChem CID 139459336) has the molecular formula C22H48N6O and a molecular weight of 412.67 g/mol. Its IUPAC name is 1-[4-[1-[[amino-(propan-2-ylamino)methylidene]amino]ethyl]-7-(tert-butylamino)-6-methylheptan-2-yl]-3-propan-2-ylurea.
| Compound Name | 1-[4-[1-[[amino-(propan-2-ylamino)methylidene]amino]ethyl]-7-(tert-butylamino)-6-methylheptan-2-yl]-3-propan-2-ylurea |
|---|---|
| PubChem CID | 139459336 |
| Molecular Formula | C22H48N6O |
| Molecular Weight | 412.67 g/mol |
| Exact Mass | 412.39 |
| IUPAC Name | 1-[4-[1-[[amino-(propan-2-ylamino)methylidene]amino]ethyl]-7-(tert-butylamino)-6-methylheptan-2-yl]-3-propan-2-ylurea |
| SMILES | CC(CNC(C)(C)C)CC(CC(C)NC(=O)NC(C)C)C(C)/N=C(\N)NC(C)C |
| InChI | InChI=1S/C22H48N6O/c1-14(2)25-20(23)28-18(7)19(11-16(5)13-24-22(8,9)10)12-17(6)27-21(29)26-15(3)4/h14-19,24H,11-13H2,1-10H3,(H3,23,25,28)(H2,26,27,29) |
| InChIKey | HZNOCXMNUGSIRL-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 103.57 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.67 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|