C24H49NO2S — CID 139460148
6-(5-methyldodecan-5-yl)-2-(3-methylhexan-3-yl)thiazinane 1,1-dioxide (PubChem CID 139460148) has the molecular formula C24H49NO2S and a molecular weight of 415.73 g/mol. Its IUPAC name is 6-(5-methyldodecan-5-yl)-2-(3-methylhexan-3-yl)thiazinane 1,1-dioxide.
| Compound Name | 6-(5-methyldodecan-5-yl)-2-(3-methylhexan-3-yl)thiazinane 1,1-dioxide |
|---|---|
| PubChem CID | 139460148 |
| Molecular Formula | C24H49NO2S |
| Molecular Weight | 415.73 g/mol |
| Exact Mass | 415.35 |
| IUPAC Name | 6-(5-methyldodecan-5-yl)-2-(3-methylhexan-3-yl)thiazinane 1,1-dioxide |
| SMILES | CCCCCCCC(C)(CCCC)C1CCCN(C(C)(CC)CCC)S1(=O)=O |
| InChI | InChI=1S/C24H49NO2S/c1-7-11-13-14-15-20-23(5,19-12-8-2)22-17-16-21-25(28(22,26)27)24(6,10-4)18-9-3/h22H,7-21H2,1-6H3 |
| InChIKey | MUIWZEIRJLTFHB-UHFFFAOYSA-N |
| XLogP | 7.31 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.73 |
| LogP ≤ 5 | 7.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|