C30H26F3N3O5 — CID 139462398
4-[2-(dimethylamino)ethoxy]-2-methyl-6-[[6-[[6-(trifluoromethyl)-3-pyridinyl]methoxy]-3-pyridinyl]oxy]xanthen-9-one (PubChem CID 139462398) has the molecular formula C30H26F3N3O5 and a molecular weight of 565.55 g/mol. Its IUPAC name is 4-[2-(dimethylamino)ethoxy]-2-methyl-6-[[6-[[6-(trifluoromethyl)-3-pyridinyl]methoxy]-3-pyridinyl]oxy]xanthen-9-one.
| Compound Name | 4-[2-(dimethylamino)ethoxy]-2-methyl-6-[[6-[[6-(trifluoromethyl)-3-pyridinyl]methoxy]-3-pyridinyl]oxy]xanthen-9-one |
|---|---|
| PubChem CID | 139462398 |
| Molecular Formula | C30H26F3N3O5 |
| Molecular Weight | 565.55 g/mol |
| Exact Mass | 565.18 |
| IUPAC Name | 4-[2-(dimethylamino)ethoxy]-2-methyl-6-[[6-[[6-(trifluoromethyl)-3-pyridinyl]methoxy]-3-pyridinyl]oxy]xanthen-9-one |
| SMILES | Cc1cc(OCCN(C)C)c2oc3cc(Oc4ccc(OCc5ccc(C(F)(F)F)nc5)nc4)ccc3c(=O)c2c1 |
| InChI | InChI=1S/C30H26F3N3O5/c1-18-12-23-28(37)22-7-5-20(14-24(22)41-29(23)25(13-18)38-11-10-36(2)3)40-21-6-9-27(35-16-21)39-17-19-4-8-26(34-15-19)30(31,32)33/h4-9,12-16H,10-11,17H2,1-3H3 |
| InChIKey | OTJAOVKRLINQNF-UHFFFAOYSA-N |
| XLogP | 6.38 |
| TPSA | 86.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.55 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|