C28H33IN6O4 — CID 139462728
N-[3-[2-[4-[[2-iodo-1-(2-methoxyethyl)pyrrolidin-3-yl]-methylamino]anilino]-5-methoxypyrimidin-4-yl]oxyphenyl]prop-2-enamide (PubChem CID 139462728) has the molecular formula C28H33IN6O4 and a molecular weight of 644.51 g/mol. Its IUPAC name is N-[3-[2-[4-[[2-iodo-1-(2-methoxyethyl)pyrrolidin-3-yl]-methylamino]anilino]-5-methoxypyrimidin-4-yl]oxyphenyl]prop-2-enamide.
| Compound Name | N-[3-[2-[4-[[2-iodo-1-(2-methoxyethyl)pyrrolidin-3-yl]-methylamino]anilino]-5-methoxypyrimidin-4-yl]oxyphenyl]prop-2-enamide |
|---|---|
| PubChem CID | 139462728 |
| Molecular Formula | C28H33IN6O4 |
| Molecular Weight | 644.51 g/mol |
| Exact Mass | 644.16 |
| IUPAC Name | N-[3-[2-[4-[[2-iodo-1-(2-methoxyethyl)pyrrolidin-3-yl]-methylamino]anilino]-5-methoxypyrimidin-4-yl]oxyphenyl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1cccc(Oc2nc(Nc3ccc(N(C)C4CCN(CCOC)C4I)cc3)ncc2OC)c1 |
| InChI | InChI=1S/C28H33IN6O4/c1-5-25(36)31-20-7-6-8-22(17-20)39-27-24(38-4)18-30-28(33-27)32-19-9-11-21(12-10-19)34(2)23-13-14-35(26(23)29)15-16-37-3/h5-12,17-18,23,26H,1,13-16H2,2-4H3,(H,31,36)(H,30,32,33) |
| InChIKey | WWHLQLRXVPESOK-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 101.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 644.51 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|