C20H21F2NO3 — CID 139466537
benzyl 3-(2,6-difluoro-4-methoxyphenyl)piperidine-4-carboxylate (PubChem CID 139466537) has the molecular formula C20H21F2NO3 and a molecular weight of 361.39 g/mol. Its IUPAC name is benzyl 3-(2,6-difluoro-4-methoxyphenyl)piperidine-4-carboxylate.
| Compound Name | benzyl 3-(2,6-difluoro-4-methoxyphenyl)piperidine-4-carboxylate |
|---|---|
| PubChem CID | 139466537 |
| Molecular Formula | C20H21F2NO3 |
| Molecular Weight | 361.39 g/mol |
| Exact Mass | 361.15 |
| IUPAC Name | benzyl 3-(2,6-difluoro-4-methoxyphenyl)piperidine-4-carboxylate |
| SMILES | COc1cc(F)c(C2CNCCC2C(=O)OCc2ccccc2)c(F)c1 |
| InChI | InChI=1S/C20H21F2NO3/c1-25-14-9-17(21)19(18(22)10-14)16-11-23-8-7-15(16)20(24)26-12-13-5-3-2-4-6-13/h2-6,9-10,15-16,23H,7-8,11-12H2,1H3 |
| InChIKey | CPBCFDPYCZDVDI-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.39 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |