C15H13F6NO5 — CID 139466583
ethyl 4-[5-hydroxy-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]benzoate;2,2,2-trifluoroacetaldehyde (PubChem CID 139466583) has the molecular formula C15H13F6NO5 and a molecular weight of 401.26 g/mol. Its IUPAC name is ethyl 4-[5-hydroxy-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]benzoate;2,2,2-trifluoroacetaldehyde.
| Compound Name | ethyl 4-[5-hydroxy-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]benzoate;2,2,2-trifluoroacetaldehyde |
|---|---|
| PubChem CID | 139466583 |
| Molecular Formula | C15H13F6NO5 |
| Molecular Weight | 401.26 g/mol |
| Exact Mass | 401.07 |
| IUPAC Name | ethyl 4-[5-hydroxy-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]benzoate;2,2,2-trifluoroacetaldehyde |
| SMILES | CCOC(=O)c1ccc(C2=NOC(O)(C(F)(F)F)C2)cc1.O=CC(F)(F)F |
| InChI | InChI=1S/C13H12F3NO4.C2HF3O/c1-2-20-11(18)9-5-3-8(4-6-9)10-7-12(19,21-17-10)13(14,15)16;3-2(4,5)1-6/h3-6,19H,2,7H2,1H3;1H |
| InChIKey | AWULNEYUGJEVSH-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 85.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.26 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|