C25H28ClNO3 — CID 139467459
(4S)-7-chloro-5'-hex-5-enylspiro[2,3-dihydro-1H-naphthalene-4,3'-2,4-dihydro-1,5-benzoxazepine]-7'-carboxylic acid (PubChem CID 139467459) has the molecular formula C25H28ClNO3 and a molecular weight of 425.96 g/mol. Its IUPAC name is (4S)-7-chloro-5'-hex-5-enylspiro[2,3-dihydro-1H-naphthalene-4,3'-2,4-dihydro-1,5-benzoxazepine]-7'-carboxylic acid.
| Compound Name | (4S)-7-chloro-5'-hex-5-enylspiro[2,3-dihydro-1H-naphthalene-4,3'-2,4-dihydro-1,5-benzoxazepine]-7'-carboxylic acid |
|---|---|
| PubChem CID | 139467459 |
| Molecular Formula | C25H28ClNO3 |
| Molecular Weight | 425.96 g/mol |
| Exact Mass | 425.18 |
| IUPAC Name | (4S)-7-chloro-5'-hex-5-enylspiro[2,3-dihydro-1H-naphthalene-4,3'-2,4-dihydro-1,5-benzoxazepine]-7'-carboxylic acid |
| SMILES | C=CCCCCN1C[C@@]2(CCCc3cc(Cl)ccc32)COc2ccc(C(=O)O)cc21 |
| InChI | InChI=1S/C25H28ClNO3/c1-2-3-4-5-13-27-16-25(12-6-7-18-14-20(26)9-10-21(18)25)17-30-23-11-8-19(24(28)29)15-22(23)27/h2,8-11,14-15H,1,3-7,12-13,16-17H2,(H,28,29)/t25-/m0/s1 |
| InChIKey | NRRXYZGRJUBXFA-VWLOTQADSA-N |
| XLogP | 5.87 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.96 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|