C16H30N2 — CID 139470679
N'-[(2S)-4-(4,4-dimethylcyclohexa-1,5-dien-1-yl)butan-2-yl]-N'-propylmethanediamine (PubChem CID 139470679) has the molecular formula C16H30N2 and a molecular weight of 250.43 g/mol. Its IUPAC name is N'-[(2S)-4-(4,4-dimethylcyclohexa-1,5-dien-1-yl)butan-2-yl]-N'-propylmethanediamine.
| Compound Name | N'-[(2S)-4-(4,4-dimethylcyclohexa-1,5-dien-1-yl)butan-2-yl]-N'-propylmethanediamine |
|---|---|
| PubChem CID | 139470679 |
| Molecular Formula | C16H30N2 |
| Molecular Weight | 250.43 g/mol |
| Exact Mass | 250.24 |
| IUPAC Name | N'-[(2S)-4-(4,4-dimethylcyclohexa-1,5-dien-1-yl)butan-2-yl]-N'-propylmethanediamine |
| SMILES | CCCN(CN)[C@@H](C)CCC1=CCC(C)(C)C=C1 |
| InChI | InChI=1S/C16H30N2/c1-5-12-18(13-17)14(2)6-7-15-8-10-16(3,4)11-9-15/h8-10,14H,5-7,11-13,17H2,1-4H3/t14-/m0/s1 |
| InChIKey | PQCKYSNJGLOEFX-AWEZNQCLSA-N |
| XLogP | 3.70 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.43 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|