C11H20N2 — CID 163541583
1-(1,4-dimethylcyclohexa-2,4-dien-1-yl)-N',N'-dimethylmethanediamine (PubChem CID 163541583) has the molecular formula C11H20N2 and a molecular weight of 180.29 g/mol. Its IUPAC name is 1-(1,4-dimethylcyclohexa-2,4-dien-1-yl)-N',N'-dimethylmethanediamine.
| Compound Name | 1-(1,4-dimethylcyclohexa-2,4-dien-1-yl)-N',N'-dimethylmethanediamine |
|---|---|
| PubChem CID | 163541583 |
| Molecular Formula | C11H20N2 |
| Molecular Weight | 180.29 g/mol |
| Exact Mass | 180.16 |
| IUPAC Name | 1-(1,4-dimethylcyclohexa-2,4-dien-1-yl)-N',N'-dimethylmethanediamine |
| SMILES | CC1=CCC(C)(C(N)N(C)C)C=C1 |
| InChI | InChI=1S/C11H20N2/c1-9-5-7-11(2,8-6-9)10(12)13(3)4/h5-7,10H,8,12H2,1-4H3 |
| InChIKey | FBNPDIFOKBURBS-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.29 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|