C20H39N3 — CID 129054006
3-N-[(2E)-2,3-ditert-butylpenta-2,4-dienyl]-3-N,4-dimethylpent-4-ene-1,1,3-triamine (PubChem CID 129054006) has the molecular formula C20H39N3 and a molecular weight of 321.55 g/mol. Its IUPAC name is 3-N-[(2E)-2,3-ditert-butylpenta-2,4-dienyl]-3-N,4-dimethylpent-4-ene-1,1,3-triamine.
| Compound Name | 3-N-[(2E)-2,3-ditert-butylpenta-2,4-dienyl]-3-N,4-dimethylpent-4-ene-1,1,3-triamine |
|---|---|
| PubChem CID | 129054006 |
| Molecular Formula | C20H39N3 |
| Molecular Weight | 321.55 g/mol |
| Exact Mass | 321.31 |
| IUPAC Name | 3-N-[(2E)-2,3-ditert-butylpenta-2,4-dienyl]-3-N,4-dimethylpent-4-ene-1,1,3-triamine |
| SMILES | C=C/C(=C(\CN(C)C(CC(N)N)C(=C)C)C(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C20H39N3/c1-11-15(19(4,5)6)16(20(7,8)9)13-23(10)17(14(2)3)12-18(21)22/h11,17-18H,1-2,12-13,21-22H2,3-10H3/b16-15- |
| InChIKey | HFIGRYJDYBVWQV-NXVVXOECSA-N |
| XLogP | 4.07 |
| TPSA | 55.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.55 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|