C21H34N2 — CID 134525712
2-(aminomethyl)-3,5-dimethyl-5-[(3E,5Z)-nona-1,3,5-trien-4-yl]-N-propan-2-ylcyclohexa-1,3-dien-1-amine (PubChem CID 134525712) has the molecular formula C21H34N2 and a molecular weight of 314.52 g/mol. Its IUPAC name is 2-(aminomethyl)-3,5-dimethyl-5-[(3E,5Z)-nona-1,3,5-trien-4-yl]-N-propan-2-ylcyclohexa-1,3-dien-1-amine.
| Compound Name | 2-(aminomethyl)-3,5-dimethyl-5-[(3E,5Z)-nona-1,3,5-trien-4-yl]-N-propan-2-ylcyclohexa-1,3-dien-1-amine |
|---|---|
| PubChem CID | 134525712 |
| Molecular Formula | C21H34N2 |
| Molecular Weight | 314.52 g/mol |
| Exact Mass | 314.27 |
| IUPAC Name | 2-(aminomethyl)-3,5-dimethyl-5-[(3E,5Z)-nona-1,3,5-trien-4-yl]-N-propan-2-ylcyclohexa-1,3-dien-1-amine |
| SMILES | C=C/C=C(\C=C/CCC)C1(C)C=C(C)C(CN)=C(NC(C)C)C1 |
| InChI | InChI=1S/C21H34N2/c1-7-9-10-12-18(11-8-2)21(6)13-17(5)19(15-22)20(14-21)23-16(3)4/h8,10-13,16,23H,2,7,9,14-15,22H2,1,3-6H3/b12-10-,18-11+ |
| InChIKey | GEKTYVAPMKTACO-KPGOJGKGSA-N |
| XLogP | 5.02 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.52 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|