C21H32F2N2 — CID 176540313
(2E)-3-(3,3-difluoroprop-1-en-2-yl)-4-N-[1-(1,4-dimethylcyclohex-3-en-1-yl)ethyl]-2-N,2-N-dimethylhexa-2,4,5-triene-2,4-diamine (PubChem CID 176540313) has the molecular formula C21H32F2N2 and a molecular weight of 350.50 g/mol. Its IUPAC name is (2E)-3-(3,3-difluoroprop-1-en-2-yl)-4-N-[1-(1,4-dimethylcyclohex-3-en-1-yl)ethyl]-2-N,2-N-dimethylhexa-2,4,5-triene-2,4-diamine.
| Compound Name | (2E)-3-(3,3-difluoroprop-1-en-2-yl)-4-N-[1-(1,4-dimethylcyclohex-3-en-1-yl)ethyl]-2-N,2-N-dimethylhexa-2,4,5-triene-2,4-diamine |
|---|---|
| PubChem CID | 176540313 |
| Molecular Formula | C21H32F2N2 |
| Molecular Weight | 350.50 g/mol |
| Exact Mass | 350.25 |
| IUPAC Name | (2E)-3-(3,3-difluoroprop-1-en-2-yl)-4-N-[1-(1,4-dimethylcyclohex-3-en-1-yl)ethyl]-2-N,2-N-dimethylhexa-2,4,5-triene-2,4-diamine |
| SMILES | C=C=C(NC(C)C1(C)CC=C(C)CC1)/C(C(=C)C(F)F)=C(\C)N(C)C |
| InChI | InChI=1S/C21H32F2N2/c1-9-18(19(15(3)20(22)23)16(4)25(7)8)24-17(5)21(6)12-10-14(2)11-13-21/h10,17,20,24H,1,3,11-13H2,2,4-8H3/b19-16+ |
| InChIKey | HELIAZSKHMMKFX-KNTRCKAVSA-N |
| XLogP | 5.43 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.50 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|