C26H45FN2 — CID 170059178
N,N'-diethyl-N'-[(5E,11Z,13E)-13-fluoro-10-methylidene-6-[(Z)-prop-1-enyl]pentadeca-5,11,13-trien-7-yl]propane-1,3-diamine (PubChem CID 170059178) has the molecular formula C26H45FN2 and a molecular weight of 404.66 g/mol. Its IUPAC name is N,N'-diethyl-N'-[(5E,11Z,13E)-13-fluoro-10-methylidene-6-[(Z)-prop-1-enyl]pentadeca-5,11,13-trien-7-yl]propane-1,3-diamine.
| Compound Name | N,N'-diethyl-N'-[(5E,11Z,13E)-13-fluoro-10-methylidene-6-[(Z)-prop-1-enyl]pentadeca-5,11,13-trien-7-yl]propane-1,3-diamine |
|---|---|
| PubChem CID | 170059178 |
| Molecular Formula | C26H45FN2 |
| Molecular Weight | 404.66 g/mol |
| Exact Mass | 404.36 |
| IUPAC Name | N,N'-diethyl-N'-[(5E,11Z,13E)-13-fluoro-10-methylidene-6-[(Z)-prop-1-enyl]pentadeca-5,11,13-trien-7-yl]propane-1,3-diamine |
| SMILES | C=C(/C=C\C(F)=C/C)CCC(C(/C=C\C)=C/CCCC)N(CC)CCCNCC |
| InChI | InChI=1S/C26H45FN2/c1-7-12-13-16-24(15-8-2)26(29(11-5)22-14-21-28-10-4)20-18-23(6)17-19-25(27)9-3/h8-9,15-17,19,26,28H,6-7,10-14,18,20-22H2,1-5H3/b15-8-,19-17-,24-16+,25-9+ |
| InChIKey | SHOUXUVVXJKXJA-FWMKTMKMSA-N |
| XLogP | 7.14 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.66 |
| LogP ≤ 5 | 7.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|