C17H30N2 — CID 135280828
[(2R)-1-(2,2-dimethylpropyl)-3-[(2E,5Z,7Z)-nona-2,5,7-trien-2-yl]aziridin-2-yl]methanamine (PubChem CID 135280828) has the molecular formula C17H30N2 and a molecular weight of 262.44 g/mol. Its IUPAC name is [(2R)-1-(2,2-dimethylpropyl)-3-[(2E,5Z,7Z)-nona-2,5,7-trien-2-yl]aziridin-2-yl]methanamine.
| Compound Name | [(2R)-1-(2,2-dimethylpropyl)-3-[(2E,5Z,7Z)-nona-2,5,7-trien-2-yl]aziridin-2-yl]methanamine |
|---|---|
| PubChem CID | 135280828 |
| Molecular Formula | C17H30N2 |
| Molecular Weight | 262.44 g/mol |
| Exact Mass | 262.24 |
| IUPAC Name | [(2R)-1-(2,2-dimethylpropyl)-3-[(2E,5Z,7Z)-nona-2,5,7-trien-2-yl]aziridin-2-yl]methanamine |
| SMILES | C/C=C\C=C/C/C=C(\C)C1[C@@H](CN)N1CC(C)(C)C |
| InChI | InChI=1S/C17H30N2/c1-6-7-8-9-10-11-14(2)16-15(12-18)19(16)13-17(3,4)5/h6-9,11,15-16H,10,12-13,18H2,1-5H3/b7-6-,9-8-,14-11+/t15-,16?,19?/m1/s1 |
| InChIKey | GAVCVEVVHSDGGM-ULCMQJKXSA-N |
| XLogP | 3.51 |
| TPSA | 29.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.44 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|