C19H35N3 — CID 134270284
(4E,6Z)-1-N'-butan-2-yl-1-N-cyclopropyl-3-N,3-N,4-trimethylnona-4,6,8-triene-1,1,3-triamine (PubChem CID 134270284) has the molecular formula C19H35N3 and a molecular weight of 305.51 g/mol. Its IUPAC name is (4E,6Z)-1-N'-butan-2-yl-1-N-cyclopropyl-3-N,3-N,4-trimethylnona-4,6,8-triene-1,1,3-triamine.
| Compound Name | (4E,6Z)-1-N'-butan-2-yl-1-N-cyclopropyl-3-N,3-N,4-trimethylnona-4,6,8-triene-1,1,3-triamine |
|---|---|
| PubChem CID | 134270284 |
| Molecular Formula | C19H35N3 |
| Molecular Weight | 305.51 g/mol |
| Exact Mass | 305.28 |
| IUPAC Name | (4E,6Z)-1-N'-butan-2-yl-1-N-cyclopropyl-3-N,3-N,4-trimethylnona-4,6,8-triene-1,1,3-triamine |
| SMILES | C=C/C=C\C=C(/C)C(CC(NC(C)CC)NC1CC1)N(C)C |
| InChI | InChI=1S/C19H35N3/c1-7-9-10-11-15(3)18(22(5)6)14-19(20-16(4)8-2)21-17-12-13-17/h7,9-11,16-21H,1,8,12-14H2,2-6H3/b10-9-,15-11+ |
| InChIKey | GEPLIKGPJNAHBL-JCCAHGDBSA-N |
| XLogP | 3.46 |
| TPSA | 27.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.51 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|