C18H30N2 — CID 139378390
1-N-cyclopropyl-1-N'-[(2Z,4E,5Z)-4-ethylidene-8-methylnona-2,5,7-trien-3-yl]-1-N'-methylethane-1,1-diamine (PubChem CID 139378390) has the molecular formula C18H30N2 and a molecular weight of 274.45 g/mol. Its IUPAC name is 1-N-cyclopropyl-1-N'-[(2Z,4E,5Z)-4-ethylidene-8-methylnona-2,5,7-trien-3-yl]-1-N'-methylethane-1,1-diamine.
| Compound Name | 1-N-cyclopropyl-1-N'-[(2Z,4E,5Z)-4-ethylidene-8-methylnona-2,5,7-trien-3-yl]-1-N'-methylethane-1,1-diamine |
|---|---|
| PubChem CID | 139378390 |
| Molecular Formula | C18H30N2 |
| Molecular Weight | 274.45 g/mol |
| Exact Mass | 274.24 |
| IUPAC Name | 1-N-cyclopropyl-1-N'-[(2Z,4E,5Z)-4-ethylidene-8-methylnona-2,5,7-trien-3-yl]-1-N'-methylethane-1,1-diamine |
| SMILES | C/C=C(C(/C=C\C=C(C)C)=C/C)\N(C)C(C)NC1CC1 |
| InChI | InChI=1S/C18H30N2/c1-7-16(11-9-10-14(3)4)18(8-2)20(6)15(5)19-17-12-13-17/h7-11,15,17,19H,12-13H2,1-6H3/b11-9-,16-7+,18-8- |
| InChIKey | XWZREXNRDAPHFX-ZRVJFOBFSA-N |
| XLogP | 4.39 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.45 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|