C14H22N2 — CID 130461522
1-N'-[(3Z,5Z)-4-ethenylhepta-1,3,5-trien-2-yl]-1-N-propan-2-ylethene-1,1-diamine (PubChem CID 130461522) has the molecular formula C14H22N2 and a molecular weight of 218.34 g/mol. Its IUPAC name is 1-N'-[(3Z,5Z)-4-ethenylhepta-1,3,5-trien-2-yl]-1-N-propan-2-ylethene-1,1-diamine.
| Compound Name | 1-N'-[(3Z,5Z)-4-ethenylhepta-1,3,5-trien-2-yl]-1-N-propan-2-ylethene-1,1-diamine |
|---|---|
| PubChem CID | 130461522 |
| Molecular Formula | C14H22N2 |
| Molecular Weight | 218.34 g/mol |
| Exact Mass | 218.18 |
| IUPAC Name | 1-N'-[(3Z,5Z)-4-ethenylhepta-1,3,5-trien-2-yl]-1-N-propan-2-ylethene-1,1-diamine |
| SMILES | C=CC(/C=C\C)=C/C(=C)NC(=C)NC(C)C |
| InChI | InChI=1S/C14H22N2/c1-7-9-14(8-2)10-12(5)16-13(6)15-11(3)4/h7-11,15-16H,2,5-6H2,1,3-4H3/b9-7-,14-10- |
| InChIKey | FHDKRNNEHWPJSA-JFKXSGPMSA-N |
| XLogP | 3.25 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.34 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|