C14H27N3 — CID 88976883
(1R,2E)-1-N'-[(Z)-but-2-en-2-yl]-1-N'-ethyl-2-[(Z)-pent-2-enylidene]propane-1,1,3-triamine (PubChem CID 88976883) has the molecular formula C14H27N3 and a molecular weight of 237.39 g/mol. Its IUPAC name is (1R,2E)-1-N'-[(Z)-but-2-en-2-yl]-1-N'-ethyl-2-[(Z)-pent-2-enylidene]propane-1,1,3-triamine.
| Compound Name | (1R,2E)-1-N'-[(Z)-but-2-en-2-yl]-1-N'-ethyl-2-[(Z)-pent-2-enylidene]propane-1,1,3-triamine |
|---|---|
| PubChem CID | 88976883 |
| Molecular Formula | C14H27N3 |
| Molecular Weight | 237.39 g/mol |
| Exact Mass | 237.22 |
| IUPAC Name | (1R,2E)-1-N'-[(Z)-but-2-en-2-yl]-1-N'-ethyl-2-[(Z)-pent-2-enylidene]propane-1,1,3-triamine |
| SMILES | C/C=C(/C)N(CC)[C@@H](N)/C(=C/C=C\CC)CN |
| InChI | InChI=1S/C14H27N3/c1-5-8-9-10-13(11-15)14(16)17(7-3)12(4)6-2/h6,8-10,14H,5,7,11,15-16H2,1-4H3/b9-8-,12-6-,13-10+/t14-/m1/s1 |
| InChIKey | SOIINPMZVHXYQV-MDELPWASSA-N |
| XLogP | 2.37 |
| TPSA | 55.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.39 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|