C14H22N2 — CID 129232825
(3E)-N-[2-(4-methyl-1,2-dihydropyridin-6-yl)ethyl]hexa-1,3-dien-2-amine (PubChem CID 129232825) has the molecular formula C14H22N2 and a molecular weight of 218.34 g/mol. Its IUPAC name is (3E)-N-[2-(4-methyl-1,2-dihydropyridin-6-yl)ethyl]hexa-1,3-dien-2-amine.
| Compound Name | (3E)-N-[2-(4-methyl-1,2-dihydropyridin-6-yl)ethyl]hexa-1,3-dien-2-amine |
|---|---|
| PubChem CID | 129232825 |
| Molecular Formula | C14H22N2 |
| Molecular Weight | 218.34 g/mol |
| Exact Mass | 218.18 |
| IUPAC Name | (3E)-N-[2-(4-methyl-1,2-dihydropyridin-6-yl)ethyl]hexa-1,3-dien-2-amine |
| SMILES | C=C(/C=C/CC)NCCC1=CC(C)=CCN1 |
| InChI | InChI=1S/C14H22N2/c1-4-5-6-13(3)15-10-8-14-11-12(2)7-9-16-14/h5-7,11,15-16H,3-4,8-10H2,1-2H3/b6-5+ |
| InChIKey | WDDKYJVOSGLYTJ-AATRIKPKSA-N |
| XLogP | 2.88 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.34 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|