C24H38N2 — CID 137401166
1-N'-[(2E,4Z)-3,6-dimethylhepta-2,4,6-trien-2-yl]-1-N-[(3E,5Z)-5-methylhepta-1,3,5-trien-3-yl]-1-N'-pentylethene-1,1-diamine (PubChem CID 137401166) has the molecular formula C24H38N2 and a molecular weight of 354.58 g/mol. Its IUPAC name is 1-N'-[(2E,4Z)-3,6-dimethylhepta-2,4,6-trien-2-yl]-1-N-[(3E,5Z)-5-methylhepta-1,3,5-trien-3-yl]-1-N'-pentylethene-1,1-diamine.
| Compound Name | 1-N'-[(2E,4Z)-3,6-dimethylhepta-2,4,6-trien-2-yl]-1-N-[(3E,5Z)-5-methylhepta-1,3,5-trien-3-yl]-1-N'-pentylethene-1,1-diamine |
|---|---|
| PubChem CID | 137401166 |
| Molecular Formula | C24H38N2 |
| Molecular Weight | 354.58 g/mol |
| Exact Mass | 354.30 |
| IUPAC Name | 1-N'-[(2E,4Z)-3,6-dimethylhepta-2,4,6-trien-2-yl]-1-N-[(3E,5Z)-5-methylhepta-1,3,5-trien-3-yl]-1-N'-pentylethene-1,1-diamine |
| SMILES | C=C/C(=C\C(C)=C/C)NC(=C)N(CCCCC)/C(C)=C(C)/C=C\C(=C)C |
| InChI | InChI=1S/C24H38N2/c1-10-13-14-17-26(22(8)21(7)16-15-19(4)5)23(9)25-24(12-3)18-20(6)11-2/h11-12,15-16,18,25H,3-4,9-10,13-14,17H2,1-2,5-8H3/b16-15-,20-11-,22-21+,24-18+ |
| InChIKey | AMCQWJYPEZGXQA-BSWWDDJZSA-N |
| XLogP | 7.00 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.58 |
| LogP ≤ 5 | 7.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|