C29H51N3 — CID 118890336
N'-methyl-N-[(2E,4E)-4-methylhepta-2,4,6-trien-3-yl]-N'-[6-[[(2E,5Z)-4-methylidenehepta-2,5-dien-3-yl]amino]hexyl]hexane-1,6-diamine (PubChem CID 118890336) has the molecular formula C29H51N3 and a molecular weight of 441.75 g/mol. Its IUPAC name is N'-methyl-N-[(2E,4E)-4-methylhepta-2,4,6-trien-3-yl]-N'-[6-[[(2E,5Z)-4-methylidenehepta-2,5-dien-3-yl]amino]hexyl]hexane-1,6-diamine.
| Compound Name | N'-methyl-N-[(2E,4E)-4-methylhepta-2,4,6-trien-3-yl]-N'-[6-[[(2E,5Z)-4-methylidenehepta-2,5-dien-3-yl]amino]hexyl]hexane-1,6-diamine |
|---|---|
| PubChem CID | 118890336 |
| Molecular Formula | C29H51N3 |
| Molecular Weight | 441.75 g/mol |
| Exact Mass | 441.41 |
| IUPAC Name | N'-methyl-N-[(2E,4E)-4-methylhepta-2,4,6-trien-3-yl]-N'-[6-[[(2E,5Z)-4-methylidenehepta-2,5-dien-3-yl]amino]hexyl]hexane-1,6-diamine |
| SMILES | C=C/C=C(C)/C(=C\C)NCCCCCCN(C)CCCCCCN/C(=C/C)C(=C)/C=C\C |
| InChI | InChI=1S/C29H51N3/c1-8-20-26(5)28(10-3)30-22-16-12-14-18-24-32(7)25-19-15-13-17-23-31-29(11-4)27(6)21-9-2/h8-11,20-21,30-31H,1,6,12-19,22-25H2,2-5,7H3/b21-9-,26-20+,28-10+,29-11+ |
| InChIKey | ATHFTDUKDKJPDT-DMQJWZHKSA-N |
| XLogP | 7.29 |
| TPSA | 27.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.75 |
| LogP ≤ 5 | 7.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|