C17H29FN2 — CID 174256450
(4E,6Z)-5-N-fluoro-1-N-methyl-5-N-[(3Z,5Z)-4-methylhepta-3,5-dienyl]octa-4,6-diene-1,5-diamine (PubChem CID 174256450) has the molecular formula C17H29FN2 and a molecular weight of 280.43 g/mol. Its IUPAC name is (4E,6Z)-5-N-fluoro-1-N-methyl-5-N-[(3Z,5Z)-4-methylhepta-3,5-dienyl]octa-4,6-diene-1,5-diamine.
| Compound Name | (4E,6Z)-5-N-fluoro-1-N-methyl-5-N-[(3Z,5Z)-4-methylhepta-3,5-dienyl]octa-4,6-diene-1,5-diamine |
|---|---|
| PubChem CID | 174256450 |
| Molecular Formula | C17H29FN2 |
| Molecular Weight | 280.43 g/mol |
| Exact Mass | 280.23 |
| IUPAC Name | (4E,6Z)-5-N-fluoro-1-N-methyl-5-N-[(3Z,5Z)-4-methylhepta-3,5-dienyl]octa-4,6-diene-1,5-diamine |
| SMILES | C/C=C\C(C)=C/CCN(F)C(/C=C\C)=C/CCCNC |
| InChI | InChI=1S/C17H29FN2/c1-5-10-16(3)12-9-15-20(18)17(11-6-2)13-7-8-14-19-4/h5-6,10-13,19H,7-9,14-15H2,1-4H3/b10-5-,11-6-,16-12-,17-13+ |
| InChIKey | IGSTXQLXXIOCLO-JTXVUMPCSA-N |
| XLogP | 4.55 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.43 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|