C16H19FN2 — CID 137447140
(Z,4Z)-N-ethynyl-4-[4-[(1E)-2-fluorobuta-1,3-dienyl]-5-methyl-1,2-dihydropyrrol-3-ylidene]-2-methylbut-1-en-1-amine (PubChem CID 137447140) has the molecular formula C16H19FN2 and a molecular weight of 258.34 g/mol. Its IUPAC name is (Z,4Z)-N-ethynyl-4-[4-[(1E)-2-fluorobuta-1,3-dienyl]-5-methyl-1,2-dihydropyrrol-3-ylidene]-2-methylbut-1-en-1-amine.
| Compound Name | (Z,4Z)-N-ethynyl-4-[4-[(1E)-2-fluorobuta-1,3-dienyl]-5-methyl-1,2-dihydropyrrol-3-ylidene]-2-methylbut-1-en-1-amine |
|---|---|
| PubChem CID | 137447140 |
| Molecular Formula | C16H19FN2 |
| Molecular Weight | 258.34 g/mol |
| Exact Mass | 258.15 |
| IUPAC Name | (Z,4Z)-N-ethynyl-4-[4-[(1E)-2-fluorobuta-1,3-dienyl]-5-methyl-1,2-dihydropyrrol-3-ylidene]-2-methylbut-1-en-1-amine |
| SMILES | C#CN/C=C(/C)C/C=C1\CNC(C)=C1/C=C(/F)C=C |
| InChI | InChI=1S/C16H19FN2/c1-5-15(17)9-16-13(4)19-11-14(16)8-7-12(3)10-18-6-2/h2,5,8-10,18-19H,1,7,11H2,3-4H3/b12-10-,14-8+,15-9+ |
| InChIKey | RYEHLCDFASMTHC-QVUDPWQFSA-N |
| XLogP | 3.30 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.34 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|