C16H23FN2 — CID 154979166
(1Z,3E)-4-N-[(5-fluorocyclohepta-1,4,6-trien-1-yl)methyl]-1-N,2-dimethylhexa-1,3-diene-1,4-diamine (PubChem CID 154979166) has the molecular formula C16H23FN2 and a molecular weight of 262.37 g/mol. Its IUPAC name is (1Z,3E)-4-N-[(5-fluorocyclohepta-1,4,6-trien-1-yl)methyl]-1-N,2-dimethylhexa-1,3-diene-1,4-diamine.
| Compound Name | (1Z,3E)-4-N-[(5-fluorocyclohepta-1,4,6-trien-1-yl)methyl]-1-N,2-dimethylhexa-1,3-diene-1,4-diamine |
|---|---|
| PubChem CID | 154979166 |
| Molecular Formula | C16H23FN2 |
| Molecular Weight | 262.37 g/mol |
| Exact Mass | 262.18 |
| IUPAC Name | (1Z,3E)-4-N-[(5-fluorocyclohepta-1,4,6-trien-1-yl)methyl]-1-N,2-dimethylhexa-1,3-diene-1,4-diamine |
| SMILES | CC/C(=C\C(C)=C/NC)NCC1=CCC=C(F)C=C1 |
| InChI | InChI=1S/C16H23FN2/c1-4-16(10-13(2)11-18-3)19-12-14-6-5-7-15(17)9-8-14/h6-11,18-19H,4-5,12H2,1-3H3/b13-11-,16-10+ |
| InChIKey | HFQNBXRPQDJXCS-INBGBAMISA-N |
| XLogP | 3.73 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.37 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|