C20H29F3N2S — CID 89209217
N-tert-butylsulfanyl-5-[[[(2E,4E)-6,6,6-trifluoro-2,5-dimethylhexa-2,4-dienyl]amino]methyl]cyclohepta-1,3,6-trien-1-amine (PubChem CID 89209217) has the molecular formula C20H29F3N2S and a molecular weight of 386.53 g/mol. Its IUPAC name is N-tert-butylsulfanyl-5-[[[(2E,4E)-6,6,6-trifluoro-2,5-dimethylhexa-2,4-dienyl]amino]methyl]cyclohepta-1,3,6-trien-1-amine.
| Compound Name | N-tert-butylsulfanyl-5-[[[(2E,4E)-6,6,6-trifluoro-2,5-dimethylhexa-2,4-dienyl]amino]methyl]cyclohepta-1,3,6-trien-1-amine |
|---|---|
| PubChem CID | 89209217 |
| Molecular Formula | C20H29F3N2S |
| Molecular Weight | 386.53 g/mol |
| Exact Mass | 386.20 |
| IUPAC Name | N-tert-butylsulfanyl-5-[[[(2E,4E)-6,6,6-trifluoro-2,5-dimethylhexa-2,4-dienyl]amino]methyl]cyclohepta-1,3,6-trien-1-amine |
| SMILES | C/C(=C\C=C(/C)C(F)(F)F)CNCC1C=CC=C(NSC(C)(C)C)C=C1 |
| InChI | InChI=1S/C20H29F3N2S/c1-15(9-10-16(2)20(21,22)23)13-24-14-17-7-6-8-18(12-11-17)25-26-19(3,4)5/h6-12,17,24-25H,13-14H2,1-5H3/b15-9+,16-10+ |
| InChIKey | PHYSOJFYQZCNSA-KAVGSWPWSA-N |
| XLogP | 5.69 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.53 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|