C17H27F2N — CID 145289231
(3Z,4E)-3-[(Z)-2,2-difluorohex-4-en-3-ylidene]-N-propylocta-1,4-dien-2-amine (PubChem CID 145289231) has the molecular formula C17H27F2N and a molecular weight of 283.41 g/mol. Its IUPAC name is (3Z,4E)-3-[(Z)-2,2-difluorohex-4-en-3-ylidene]-N-propylocta-1,4-dien-2-amine.
| Compound Name | (3Z,4E)-3-[(Z)-2,2-difluorohex-4-en-3-ylidene]-N-propylocta-1,4-dien-2-amine |
|---|---|
| PubChem CID | 145289231 |
| Molecular Formula | C17H27F2N |
| Molecular Weight | 283.41 g/mol |
| Exact Mass | 283.21 |
| IUPAC Name | (3Z,4E)-3-[(Z)-2,2-difluorohex-4-en-3-ylidene]-N-propylocta-1,4-dien-2-amine |
| SMILES | C=C(NCCC)C(/C=C/CCC)=C(/C=C\C)C(C)(F)F |
| InChI | InChI=1S/C17H27F2N/c1-6-9-10-12-15(14(4)20-13-8-3)16(11-7-2)17(5,18)19/h7,10-12,20H,4,6,8-9,13H2,1-3,5H3/b11-7-,12-10+,16-15- |
| InChIKey | CHWYKJCOEAEHBC-NPBCZLELSA-N |
| XLogP | 5.38 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.41 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|