C20H34N2 — CID 134286359
2-[5-[(1Z)-buta-1,3-dienyl]-1-butan-2-yl-4-ethenyl-3-ethyl-2H-pyrrol-3-yl]-N-ethylethanamine (PubChem CID 134286359) has the molecular formula C20H34N2 and a molecular weight of 302.51 g/mol. Its IUPAC name is 2-[5-[(1Z)-buta-1,3-dienyl]-1-butan-2-yl-4-ethenyl-3-ethyl-2H-pyrrol-3-yl]-N-ethylethanamine.
| Compound Name | 2-[5-[(1Z)-buta-1,3-dienyl]-1-butan-2-yl-4-ethenyl-3-ethyl-2H-pyrrol-3-yl]-N-ethylethanamine |
|---|---|
| PubChem CID | 134286359 |
| Molecular Formula | C20H34N2 |
| Molecular Weight | 302.51 g/mol |
| Exact Mass | 302.27 |
| IUPAC Name | 2-[5-[(1Z)-buta-1,3-dienyl]-1-butan-2-yl-4-ethenyl-3-ethyl-2H-pyrrol-3-yl]-N-ethylethanamine |
| SMILES | C=C/C=C\C1=C(C=C)C(CC)(CCNCC)CN1C(C)CC |
| InChI | InChI=1S/C20H34N2/c1-7-12-13-19-18(9-3)20(10-4,14-15-21-11-5)16-22(19)17(6)8-2/h7,9,12-13,17,21H,1,3,8,10-11,14-16H2,2,4-6H3/b13-12- |
| InChIKey | DHIKFWPPXNGBGC-SEYXRHQNSA-N |
| XLogP | 4.68 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.51 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|