C18H25N7O2S2 — CID 139471956
N-[(1S)-3-[[amino(methyl)amino]sulfanylperoxymethyl]cyclopentyl]-2-pyridin-2-ylpyrazolo[1,5-a]pyrimidin-7-amine;sulfane (PubChem CID 139471956) has the molecular formula C18H25N7O2S2 and a molecular weight of 435.58 g/mol. Its IUPAC name is N-[(1S)-3-[[amino(methyl)amino]sulfanylperoxymethyl]cyclopentyl]-2-pyridin-2-ylpyrazolo[1,5-a]pyrimidin-7-amine;sulfane.
| Compound Name | N-[(1S)-3-[[amino(methyl)amino]sulfanylperoxymethyl]cyclopentyl]-2-pyridin-2-ylpyrazolo[1,5-a]pyrimidin-7-amine;sulfane |
|---|---|
| PubChem CID | 139471956 |
| Molecular Formula | C18H25N7O2S2 |
| Molecular Weight | 435.58 g/mol |
| Exact Mass | 435.15 |
| IUPAC Name | N-[(1S)-3-[[amino(methyl)amino]sulfanylperoxymethyl]cyclopentyl]-2-pyridin-2-ylpyrazolo[1,5-a]pyrimidin-7-amine;sulfane |
| SMILES | CN(N)SOOCC1CC[C@H](Nc2ccnc3cc(-c4ccccn4)nn23)C1.S |
| InChI | InChI=1S/C18H23N7O2S.H2S/c1-24(19)28-27-26-12-13-5-6-14(10-13)22-17-7-9-21-18-11-16(23-25(17)18)15-4-2-3-8-20-15;/h2-4,7-9,11,13-14,22H,5-6,10,12,19H2,1H3;1H2/t13?,14-;/m0./s1 |
| InChIKey | GXGVVABHHBJGQZ-IJDFPQMLSA-N |
| XLogP | 2.80 |
| TPSA | 102.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.58 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|