C23H28N6O3S — CID 144769938
[4-[[3-[[amino(methyl)amino]sulfanylperoxymethyl]cyclopentyl]amino]pyrimidin-5-yl]-(1-benzylpyrrol-3-yl)methanone (PubChem CID 144769938) has the molecular formula C23H28N6O3S and a molecular weight of 468.58 g/mol. Its IUPAC name is [4-[[3-[[amino(methyl)amino]sulfanylperoxymethyl]cyclopentyl]amino]pyrimidin-5-yl]-(1-benzylpyrrol-3-yl)methanone.
| Compound Name | [4-[[3-[[amino(methyl)amino]sulfanylperoxymethyl]cyclopentyl]amino]pyrimidin-5-yl]-(1-benzylpyrrol-3-yl)methanone |
|---|---|
| PubChem CID | 144769938 |
| Molecular Formula | C23H28N6O3S |
| Molecular Weight | 468.58 g/mol |
| Exact Mass | 468.19 |
| IUPAC Name | [4-[[3-[[amino(methyl)amino]sulfanylperoxymethyl]cyclopentyl]amino]pyrimidin-5-yl]-(1-benzylpyrrol-3-yl)methanone |
| SMILES | CN(N)SOOCC1CCC(Nc2ncncc2C(=O)c2ccn(Cc3ccccc3)c2)C1 |
| InChI | InChI=1S/C23H28N6O3S/c1-28(24)33-32-31-15-18-7-8-20(11-18)27-23-21(12-25-16-26-23)22(30)19-9-10-29(14-19)13-17-5-3-2-4-6-17/h2-6,9-10,12,14,16,18,20H,7-8,11,13,15,24H2,1H3,(H,25,26,27) |
| InChIKey | WDHQSRAJRFBNRD-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 107.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.58 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|