C13H19NO2 — CID 139473149
[(2R,3S)-3-(2-methylphenyl)butan-2-yl] 2-aminoacetate (PubChem CID 139473149) has the molecular formula C13H19NO2 and a molecular weight of 221.30 g/mol. Its IUPAC name is [(2R,3S)-3-(2-methylphenyl)butan-2-yl] 2-aminoacetate.
| Compound Name | [(2R,3S)-3-(2-methylphenyl)butan-2-yl] 2-aminoacetate |
|---|---|
| PubChem CID | 139473149 |
| Molecular Formula | C13H19NO2 |
| Molecular Weight | 221.30 g/mol |
| Exact Mass | 221.14 |
| IUPAC Name | [(2R,3S)-3-(2-methylphenyl)butan-2-yl] 2-aminoacetate |
| SMILES | Cc1ccccc1[C@H](C)[C@@H](C)OC(=O)CN |
| InChI | InChI=1S/C13H19NO2/c1-9-6-4-5-7-12(9)10(2)11(3)16-13(15)8-14/h4-7,10-11H,8,14H2,1-3H3/t10-,11-/m1/s1 |
| InChIKey | YQXSRTUIWHOJLZ-GHMZBOCLSA-N |
| XLogP | 1.99 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.30 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |