About 1-methyl-2-(3-methylbutan-2-yl)benzene;2-methylpropyl acetate
1-methyl-2-(3-methylbutan-2-yl)benzene;2-methylpropyl acetate (PubChem CID 159813923) has the molecular formula C18H30O2
and a molecular weight of 278.44 g/mol. Its IUPAC name is 1-methyl-2-(3-methylbutan-2-yl)benzene;2-methylpropyl acetate.
Molecular Properties
| Compound Name | 1-methyl-2-(3-methylbutan-2-yl)benzene;2-methylpropyl acetate |
| PubChem CID | 159813923 |
| Molecular Formula | C18H30O2 |
| Molecular Weight | 278.44 g/mol |
| Exact Mass | 278.22 |
| IUPAC Name | 1-methyl-2-(3-methylbutan-2-yl)benzene;2-methylpropyl acetate |
| SMILES | CC(=O)OCC(C)C.Cc1ccccc1C(C)C(C)C |
| InChI | InChI=1S/C12H18.C6H12O2/c1-9(2)11(4)12-8-6-5-7-10(12)3;1-5(2)4-8-6(3)7/h5-9,11H,1-4H3;5H,4H2,1-3H3 |
| InChIKey | NLJKXISPQOJWFD-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.44 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-methyl-2-(3-methylbutan-2-yl)benzene;2-methylpropyl acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methyl-2-(3-methylbutan-2-yl)benzene;2-methylpropyl acetate?
The IUPAC name of 1-methyl-2-(3-methylbutan-2-yl)benzene;2-methylpropyl acetate (CID 159813923) is 1-methyl-2-(3-methylbutan-2-yl)benzene;2-methylpropyl acetate.
What is the SMILES notation for 1-methyl-2-(3-methylbutan-2-yl)benzene;2-methylpropyl acetate?
The canonical SMILES for 1-methyl-2-(3-methylbutan-2-yl)benzene;2-methylpropyl acetate is CC(=O)OCC(C)C.Cc1ccccc1C(C)C(C)C.
What is the InChIKey of 1-methyl-2-(3-methylbutan-2-yl)benzene;2-methylpropyl acetate?
The InChIKey is NLJKXISPQOJWFD-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18.C6H12O2/c1-9(2)11(4)12-8-6-5-7-10(12)3;1-5(2)4-8-6(3)7/h5-9,11H,1-4H3;5H,4H2,1-3H3.
What are the key properties of 1-methyl-2-(3-methylbutan-2-yl)benzene;2-methylpropyl acetate?
1-methyl-2-(3-methylbutan-2-yl)benzene;2-methylpropyl acetate has a molecular weight of 278.44 g/mol, XLogP of 4.96, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methyl-2-(3-methylbutan-2-yl)benzene;2-methylpropyl acetate is sourced from PubChem (CID 159813923), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).