C31H30ClN9O3 — CID 139474456
(E)-1-[10-[3-chloro-4-([1,2,4]triazolo[1,5-a]pyridin-7-yloxy)anilino]-2,3-dihydropyrimido[4,5-h][1,4]benzoxazin-4-yl]-4-(4-methylpiperazin-1-yl)but-2-en-1-one (PubChem CID 139474456) has the molecular formula C31H30ClN9O3 and a molecular weight of 612.09 g/mol. Its IUPAC name is (E)-1-[10-[3-chloro-4-([1,2,4]triazolo[1,5-a]pyridin-7-yloxy)anilino]-2,3-dihydropyrimido[4,5-h][1,4]benzoxazin-4-yl]-4-(4-methylpiperazin-1-yl)but-2-en-1-one.
| Compound Name | (E)-1-[10-[3-chloro-4-([1,2,4]triazolo[1,5-a]pyridin-7-yloxy)anilino]-2,3-dihydropyrimido[4,5-h][1,4]benzoxazin-4-yl]-4-(4-methylpiperazin-1-yl)but-2-en-1-one |
|---|---|
| PubChem CID | 139474456 |
| Molecular Formula | C31H30ClN9O3 |
| Molecular Weight | 612.09 g/mol |
| Exact Mass | 611.22 |
| IUPAC Name | (E)-1-[10-[3-chloro-4-([1,2,4]triazolo[1,5-a]pyridin-7-yloxy)anilino]-2,3-dihydropyrimido[4,5-h][1,4]benzoxazin-4-yl]-4-(4-methylpiperazin-1-yl)but-2-en-1-one |
| SMILES | CN1CCN(C/C=C/C(=O)N2CCOc3c2ccc2ncnc(Nc4ccc(Oc5ccn6ncnc6c5)c(Cl)c4)c32)CC1 |
| InChI | InChI=1S/C31H30ClN9O3/c1-38-11-13-39(14-12-38)9-2-3-28(42)40-15-16-43-30-25(40)6-5-24-29(30)31(35-19-33-24)37-21-4-7-26(23(32)17-21)44-22-8-10-41-27(18-22)34-20-36-41/h2-8,10,17-20H,9,11-16H2,1H3,(H,33,35,37)/b3-2+ |
| InChIKey | GQLVZUQGLJXPRP-NSCUHMNNSA-N |
| XLogP | 4.39 |
| TPSA | 113.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.09 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|