C25H25ClFN5O2 — CID 156693106
(E)-1-[10-(3-chloro-2-fluoroanilino)-2,3-dihydropyrimido[4,5-h][1,4]benzoxazin-4-yl]-4-piperidin-1-ylbut-2-en-1-one (PubChem CID 156693106) has the molecular formula C25H25ClFN5O2 and a molecular weight of 481.96 g/mol. Its IUPAC name is (E)-1-[10-(3-chloro-2-fluoroanilino)-2,3-dihydropyrimido[4,5-h][1,4]benzoxazin-4-yl]-4-piperidin-1-ylbut-2-en-1-one.
| Compound Name | (E)-1-[10-(3-chloro-2-fluoroanilino)-2,3-dihydropyrimido[4,5-h][1,4]benzoxazin-4-yl]-4-piperidin-1-ylbut-2-en-1-one |
|---|---|
| PubChem CID | 156693106 |
| Molecular Formula | C25H25ClFN5O2 |
| Molecular Weight | 481.96 g/mol |
| Exact Mass | 481.17 |
| IUPAC Name | (E)-1-[10-(3-chloro-2-fluoroanilino)-2,3-dihydropyrimido[4,5-h][1,4]benzoxazin-4-yl]-4-piperidin-1-ylbut-2-en-1-one |
| SMILES | O=C(/C=C/CN1CCCCC1)N1CCOc2c1ccc1ncnc(Nc3cccc(Cl)c3F)c21 |
| InChI | InChI=1S/C25H25ClFN5O2/c26-17-6-4-7-19(23(17)27)30-25-22-18(28-16-29-25)9-10-20-24(22)34-15-14-32(20)21(33)8-5-13-31-11-2-1-3-12-31/h4-10,16H,1-3,11-15H2,(H,28,29,30)/b8-5+ |
| InChIKey | YGIWHWAGRAKBAX-VMPITWQZSA-N |
| XLogP | 4.93 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.96 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|