C27H22ClFN4O3 — CID 156693103
(E)-1-[10-(3-chloro-2-fluoroanilino)-2,3-dihydropyrimido[4,5-h][1,4]benzoxazin-4-yl]-4-phenylmethoxybut-2-en-1-one (PubChem CID 156693103) has the molecular formula C27H22ClFN4O3 and a molecular weight of 504.95 g/mol. Its IUPAC name is (E)-1-[10-(3-chloro-2-fluoroanilino)-2,3-dihydropyrimido[4,5-h][1,4]benzoxazin-4-yl]-4-phenylmethoxybut-2-en-1-one.
| Compound Name | (E)-1-[10-(3-chloro-2-fluoroanilino)-2,3-dihydropyrimido[4,5-h][1,4]benzoxazin-4-yl]-4-phenylmethoxybut-2-en-1-one |
|---|---|
| PubChem CID | 156693103 |
| Molecular Formula | C27H22ClFN4O3 |
| Molecular Weight | 504.95 g/mol |
| Exact Mass | 504.14 |
| IUPAC Name | (E)-1-[10-(3-chloro-2-fluoroanilino)-2,3-dihydropyrimido[4,5-h][1,4]benzoxazin-4-yl]-4-phenylmethoxybut-2-en-1-one |
| SMILES | O=C(/C=C/COCc1ccccc1)N1CCOc2c1ccc1ncnc(Nc3cccc(Cl)c3F)c21 |
| InChI | InChI=1S/C27H22ClFN4O3/c28-19-8-4-9-21(25(19)29)32-27-24-20(30-17-31-27)11-12-22-26(24)36-15-13-33(22)23(34)10-5-14-35-16-18-6-2-1-3-7-18/h1-12,17H,13-16H2,(H,30,31,32)/b10-5+ |
| InChIKey | RSLCETVBUVWQNC-BJMVGYQFSA-N |
| XLogP | 5.66 |
| TPSA | 76.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.95 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|