C20H18N4O2 — CID 155682597
1-[10-(benzylamino)-2,3-dihydropyrimido[4,5-h][1,4]benzoxazin-4-yl]prop-2-en-1-one (PubChem CID 155682597) has the molecular formula C20H18N4O2 and a molecular weight of 346.39 g/mol. Its IUPAC name is 1-[10-(benzylamino)-2,3-dihydropyrimido[4,5-h][1,4]benzoxazin-4-yl]prop-2-en-1-one.
| Compound Name | 1-[10-(benzylamino)-2,3-dihydropyrimido[4,5-h][1,4]benzoxazin-4-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 155682597 |
| Molecular Formula | C20H18N4O2 |
| Molecular Weight | 346.39 g/mol |
| Exact Mass | 346.14 |
| IUPAC Name | 1-[10-(benzylamino)-2,3-dihydropyrimido[4,5-h][1,4]benzoxazin-4-yl]prop-2-en-1-one |
| SMILES | C=CC(=O)N1CCOc2c1ccc1ncnc(NCc3ccccc3)c21 |
| InChI | InChI=1S/C20H18N4O2/c1-2-17(25)24-10-11-26-19-16(24)9-8-15-18(19)20(23-13-22-15)21-12-14-6-4-3-5-7-14/h2-9,13H,1,10-12H2,(H,21,22,23) |
| InChIKey | NGDZHPXNFKLHIT-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.39 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|