C22H17N5O3S — CID 155755932
1-[10-[4-(1,3-thiazol-2-yloxy)anilino]-2,3-dihydropyrimido[4,5-h][1,4]benzoxazin-4-yl]prop-2-en-1-one (PubChem CID 155755932) has the molecular formula C22H17N5O3S and a molecular weight of 431.48 g/mol. Its IUPAC name is 1-[10-[4-(1,3-thiazol-2-yloxy)anilino]-2,3-dihydropyrimido[4,5-h][1,4]benzoxazin-4-yl]prop-2-en-1-one.
| Compound Name | 1-[10-[4-(1,3-thiazol-2-yloxy)anilino]-2,3-dihydropyrimido[4,5-h][1,4]benzoxazin-4-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 155755932 |
| Molecular Formula | C22H17N5O3S |
| Molecular Weight | 431.48 g/mol |
| Exact Mass | 431.11 |
| IUPAC Name | 1-[10-[4-(1,3-thiazol-2-yloxy)anilino]-2,3-dihydropyrimido[4,5-h][1,4]benzoxazin-4-yl]prop-2-en-1-one |
| SMILES | C=CC(=O)N1CCOc2c1ccc1ncnc(Nc3ccc(Oc4nccs4)cc3)c21 |
| InChI | InChI=1S/C22H17N5O3S/c1-2-18(28)27-10-11-29-20-17(27)8-7-16-19(20)21(25-13-24-16)26-14-3-5-15(6-4-14)30-22-23-9-12-31-22/h2-9,12-13H,1,10-11H2,(H,24,25,26) |
| InChIKey | HRZQMIMFFOEAQN-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 89.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.48 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|