C22H18N4O2 — CID 155682677
1-[10-[(3-ethynylphenyl)methylamino]-2,3-dihydropyrimido[4,5-h][1,4]benzoxazin-4-yl]prop-2-en-1-one (PubChem CID 155682677) has the molecular formula C22H18N4O2 and a molecular weight of 370.41 g/mol. Its IUPAC name is 1-[10-[(3-ethynylphenyl)methylamino]-2,3-dihydropyrimido[4,5-h][1,4]benzoxazin-4-yl]prop-2-en-1-one.
| Compound Name | 1-[10-[(3-ethynylphenyl)methylamino]-2,3-dihydropyrimido[4,5-h][1,4]benzoxazin-4-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 155682677 |
| Molecular Formula | C22H18N4O2 |
| Molecular Weight | 370.41 g/mol |
| Exact Mass | 370.14 |
| IUPAC Name | 1-[10-[(3-ethynylphenyl)methylamino]-2,3-dihydropyrimido[4,5-h][1,4]benzoxazin-4-yl]prop-2-en-1-one |
| SMILES | C#Cc1cccc(CNc2ncnc3ccc4c(c23)OCCN4C(=O)C=C)c1 |
| InChI | InChI=1S/C22H18N4O2/c1-3-15-6-5-7-16(12-15)13-23-22-20-17(24-14-25-22)8-9-18-21(20)28-11-10-26(18)19(27)4-2/h1,4-9,12,14H,2,10-11,13H2,(H,23,24,25) |
| InChIKey | FVJPJOCYKCVFIX-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.41 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|