C28H33ClN2O5 — CID 139477525
(21E,27S)-10-chloro-27-hydroxy-24-methyl-25-oxo-5-oxa-17,24-diazatetracyclo[15.10.2.04,29.07,12]nonacosa-1(28),2,4(29),7(12),8,10,21-heptaene-27-carboxylic acid (PubChem CID 139477525) has the molecular formula C28H33ClN2O5 and a molecular weight of 513.03 g/mol. Its IUPAC name is (21E,27S)-10-chloro-27-hydroxy-24-methyl-25-oxo-5-oxa-17,24-diazatetracyclo[15.10.2.04,29.07,12]nonacosa-1(28),2,4(29),7(12),8,10,21-heptaene-27-carboxylic acid.
| Compound Name | (21E,27S)-10-chloro-27-hydroxy-24-methyl-25-oxo-5-oxa-17,24-diazatetracyclo[15.10.2.04,29.07,12]nonacosa-1(28),2,4(29),7(12),8,10,21-heptaene-27-carboxylic acid |
|---|---|
| PubChem CID | 139477525 |
| Molecular Formula | C28H33ClN2O5 |
| Molecular Weight | 513.03 g/mol |
| Exact Mass | 512.21 |
| IUPAC Name | (21E,27S)-10-chloro-27-hydroxy-24-methyl-25-oxo-5-oxa-17,24-diazatetracyclo[15.10.2.04,29.07,12]nonacosa-1(28),2,4(29),7(12),8,10,21-heptaene-27-carboxylic acid |
| SMILES | CN1C/C=C\CCCN2CCCCc3cc(Cl)ccc3COc3ccc(cc32)[C@](O)(C(=O)O)CC1=O |
| InChI | InChI=1S/C28H33ClN2O5/c1-30-13-5-2-3-6-14-31-15-7-4-8-20-16-23(29)11-9-21(20)19-36-25-12-10-22(17-24(25)31)28(35,27(33)34)18-26(30)32/h2,5,9-12,16-17,35H,3-4,6-8,13-15,18-19H2,1H3,(H,33,34)/b5-2-/t28-/m0/s1 |
| InChIKey | UXJDSMJMXGNQBS-NJTVFMNFSA-N |
| XLogP | 4.53 |
| TPSA | 90.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.03 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|