C33H41ClN2O6 — CID 139477373
methyl (19R,22R,23S,24E,31S)-10-chloro-23,31-dihydroxy-28-methyl-29-oxo-5-oxa-17,28-diazapentacyclo[15.14.2.04,33.07,12.019,22]tritriaconta-1(32),2,4(33),7(12),8,10,24-heptaene-31-carboxylate (PubChem CID 139477373) has the molecular formula C33H41ClN2O6 and a molecular weight of 597.15 g/mol. Its IUPAC name is methyl (19R,22R,23S,24E,31S)-10-chloro-23,31-dihydroxy-28-methyl-29-oxo-5-oxa-17,28-diazapentacyclo[15.14.2.04,33.07,12.019,22]tritriaconta-1(32),2,4(33),7(12),8,10,24-heptaene-31-carboxylate.
| Compound Name | methyl (19R,22R,23S,24E,31S)-10-chloro-23,31-dihydroxy-28-methyl-29-oxo-5-oxa-17,28-diazapentacyclo[15.14.2.04,33.07,12.019,22]tritriaconta-1(32),2,4(33),7(12),8,10,24-heptaene-31-carboxylate |
|---|---|
| PubChem CID | 139477373 |
| Molecular Formula | C33H41ClN2O6 |
| Molecular Weight | 597.15 g/mol |
| Exact Mass | 596.27 |
| IUPAC Name | methyl (19R,22R,23S,24E,31S)-10-chloro-23,31-dihydroxy-28-methyl-29-oxo-5-oxa-17,28-diazapentacyclo[15.14.2.04,33.07,12.019,22]tritriaconta-1(32),2,4(33),7(12),8,10,24-heptaene-31-carboxylate |
| SMILES | COC(=O)[C@]1(O)CC(=O)N(C)CC/C=C\[C@H](O)[C@@H]2CC[C@H]2CN2CCCCc3cc(Cl)ccc3COc3ccc1cc32 |
| InChI | InChI=1S/C33H41ClN2O6/c1-35-15-5-4-8-29(37)27-13-10-23(27)20-36-16-6-3-7-22-17-26(34)12-9-24(22)21-42-30-14-11-25(18-28(30)36)33(40,19-31(35)38)32(39)41-2/h4,8-9,11-12,14,17-18,23,27,29,37,40H,3,5-7,10,13,15-16,19-21H2,1-2H3/b8-4-/t23-,27+,29-,33-/m0/s1 |
| InChIKey | TUPCGHCTZHRTGE-PMHAJFSVSA-N |
| XLogP | 4.62 |
| TPSA | 99.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.15 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|