C33H42ClNO5 — CID 167297067
methyl (19R,22R,23S,24E,31S)-10-chloro-23,31-dihydroxy-5-oxa-17-azapentacyclo[15.14.2.04,33.07,12.019,22]tritriaconta-1(32),2,4(33),7(12),8,10,24-heptaene-31-carboxylate (PubChem CID 167297067) has the molecular formula C33H42ClNO5 and a molecular weight of 568.15 g/mol. Its IUPAC name is methyl (19R,22R,23S,24E,31S)-10-chloro-23,31-dihydroxy-5-oxa-17-azapentacyclo[15.14.2.04,33.07,12.019,22]tritriaconta-1(32),2,4(33),7(12),8,10,24-heptaene-31-carboxylate.
| Compound Name | methyl (19R,22R,23S,24E,31S)-10-chloro-23,31-dihydroxy-5-oxa-17-azapentacyclo[15.14.2.04,33.07,12.019,22]tritriaconta-1(32),2,4(33),7(12),8,10,24-heptaene-31-carboxylate |
|---|---|
| PubChem CID | 167297067 |
| Molecular Formula | C33H42ClNO5 |
| Molecular Weight | 568.15 g/mol |
| Exact Mass | 567.28 |
| IUPAC Name | methyl (19R,22R,23S,24E,31S)-10-chloro-23,31-dihydroxy-5-oxa-17-azapentacyclo[15.14.2.04,33.07,12.019,22]tritriaconta-1(32),2,4(33),7(12),8,10,24-heptaene-31-carboxylate |
| SMILES | COC(=O)[C@]1(O)CCCCC/C=C\[C@H](O)[C@@H]2CC[C@H]2CN2CCCCc3cc(Cl)ccc3COc3ccc1cc32 |
| InChI | InChI=1S/C33H42ClNO5/c1-39-32(37)33(38)17-7-4-2-3-5-10-30(36)28-15-12-24(28)21-35-18-8-6-9-23-19-27(34)14-11-25(23)22-40-31-16-13-26(33)20-29(31)35/h5,10-11,13-14,16,19-20,24,28,30,36,38H,2-4,6-9,12,15,17-18,21-22H2,1H3/b10-5-/t24-,28+,30-,33-/m0/s1 |
| InChIKey | KQMBQQOMVKXLMX-AOMPXQBXSA-N |
| XLogP | 6.33 |
| TPSA | 79.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.15 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|