C32H40ClN3O6 — CID 139477931
methyl (19R,22R,23S,24E,31R)-10-chloro-23,31-dihydroxy-28-methyl-29-oxo-5-oxa-17,28,32-triazapentacyclo[15.14.2.04,33.07,12.019,22]tritriaconta-1(32),2,4(33),7(12),8,10,24-heptaene-31-carboxylate (PubChem CID 139477931) has the molecular formula C32H40ClN3O6 and a molecular weight of 598.14 g/mol. Its IUPAC name is methyl (19R,22R,23S,24E,31R)-10-chloro-23,31-dihydroxy-28-methyl-29-oxo-5-oxa-17,28,32-triazapentacyclo[15.14.2.04,33.07,12.019,22]tritriaconta-1(32),2,4(33),7(12),8,10,24-heptaene-31-carboxylate.
| Compound Name | methyl (19R,22R,23S,24E,31R)-10-chloro-23,31-dihydroxy-28-methyl-29-oxo-5-oxa-17,28,32-triazapentacyclo[15.14.2.04,33.07,12.019,22]tritriaconta-1(32),2,4(33),7(12),8,10,24-heptaene-31-carboxylate |
|---|---|
| PubChem CID | 139477931 |
| Molecular Formula | C32H40ClN3O6 |
| Molecular Weight | 598.14 g/mol |
| Exact Mass | 597.26 |
| IUPAC Name | methyl (19R,22R,23S,24E,31R)-10-chloro-23,31-dihydroxy-28-methyl-29-oxo-5-oxa-17,28,32-triazapentacyclo[15.14.2.04,33.07,12.019,22]tritriaconta-1(32),2,4(33),7(12),8,10,24-heptaene-31-carboxylate |
| SMILES | COC(=O)[C@@]1(O)CC(=O)N(C)CC/C=C\[C@H](O)[C@@H]2CC[C@H]2CN2CCCCc3cc(Cl)ccc3COc3ccc1nc32 |
| InChI | InChI=1S/C32H40ClN3O6/c1-35-15-5-4-8-26(37)25-12-10-22(25)19-36-16-6-3-7-21-17-24(33)11-9-23(21)20-42-27-13-14-28(34-30(27)36)32(40,18-29(35)38)31(39)41-2/h4,8-9,11,13-14,17,22,25-26,37,40H,3,5-7,10,12,15-16,18-20H2,1-2H3/b8-4-/t22-,25+,26-,32+/m0/s1 |
| InChIKey | JIDWCZSYRPSKJF-LMOVILNVSA-N |
| XLogP | 4.01 |
| TPSA | 112.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.14 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|